C24H33N3O5 — CID 91381350
tert-butyl (4aS,8aS)-4a-methyl-2,4-dioxo-3-[(2-propan-2-ylphenyl)carbamoyl]-5,7,8,8a-tetrahydro-1H-1,6-naphthyridine-6-carboxylate (PubChem CID 91381350) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is tert-butyl (4aS,8aS)-4a-methyl-2,4-dioxo-3-[(2-propan-2-ylphenyl)carbamoyl]-5,7,8,8a-tetrahydro-1H-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl (4aS,8aS)-4a-methyl-2,4-dioxo-3-[(2-propan-2-ylphenyl)carbamoyl]-5,7,8,8a-tetrahydro-1H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 91381350 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | tert-butyl (4aS,8aS)-4a-methyl-2,4-dioxo-3-[(2-propan-2-ylphenyl)carbamoyl]-5,7,8,8a-tetrahydro-1H-1,6-naphthyridine-6-carboxylate |
| SMILES | CC(C)c1ccccc1NC(=O)C1C(=O)N[C@H]2CCN(C(=O)OC(C)(C)C)C[C@]2(C)C1=O |
| InChI | InChI=1S/C24H33N3O5/c1-14(2)15-9-7-8-10-16(15)25-20(29)18-19(28)24(6)13-27(22(31)32-23(3,4)5)12-11-17(24)26-21(18)30/h7-10,14,17-18H,11-13H2,1-6H3,(H,25,29)(H,26,30)/t17-,18?,24-/m0/s1 |
| InChIKey | KSUOYTUTRLJACI-UAYVXKRGSA-N |
| XLogP | 3.08 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|