About 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide
5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 91178170) has the molecular formula C22H24N2O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
| PubChem CID | 91178170 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)C1C(=O)NC(C)(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N2O3/c1-14(2)16-11-7-8-12-17(16)23-20(26)18-19(25)22(3,24-21(18)27)13-15-9-5-4-6-10-15/h4-12,14,18H,13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | NJXZAVAPIRYMSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide?
The IUPAC name of 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide (CID 91178170) is 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide.
What is the SMILES notation for 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide?
The canonical SMILES for 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide is CC(C)c1ccccc1NC(=O)C1C(=O)NC(C)(Cc2ccccc2)C1=O.
What is the InChIKey of 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide?
The InChIKey is NJXZAVAPIRYMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c1-14(2)16-11-7-8-12-17(16)23-20(26)18-19(25)22(3,24-21(18)27)13-15-9-5-4-6-10-15/h4-12,14,18H,13H2,1-3H3,(H,23,26)(H,24,27).
What are the key properties of 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide?
5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide has a molecular weight of 364.45 g/mol, XLogP of 3.07, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-5-methyl-2,4-dioxo-N-(2-propan-2-ylphenyl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 91178170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).