C11H20N4O — CID 79959427
4-amino-9-propyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one (PubChem CID 79959427) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-amino-9-propyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one.
| Compound Name | 4-amino-9-propyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one |
|---|---|
| PubChem CID | 79959427 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-amino-9-propyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one |
| SMILES | CCCN1CCCC2(CC1)NC(=O)N=C2N |
| InChI | InChI=1S/C11H20N4O/c1-2-6-15-7-3-4-11(5-8-15)9(12)13-10(16)14-11/h2-8H2,1H3,(H3,12,13,14,16) |
| InChIKey | BCAFIVMSORCDCL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |