C21H25N3O — CID 7327809
(5S)-1-phenyl-9-(2-phenylethyl)-1,3,9-triazaspiro[4.5]decan-4-one (PubChem CID 7327809) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (5S)-1-phenyl-9-(2-phenylethyl)-1,3,9-triazaspiro[4.5]decan-4-one.
| Compound Name | (5S)-1-phenyl-9-(2-phenylethyl)-1,3,9-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 7327809 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (5S)-1-phenyl-9-(2-phenylethyl)-1,3,9-triazaspiro[4.5]decan-4-one |
| SMILES | O=C1NCN(c2ccccc2)[C@]12CCCN(CCc1ccccc1)C2 |
| InChI | InChI=1S/C21H25N3O/c25-20-21(24(17-22-20)19-10-5-2-6-11-19)13-7-14-23(16-21)15-12-18-8-3-1-4-9-18/h1-6,8-11H,7,12-17H2,(H,22,25)/t21-/m0/s1 |
| InChIKey | JXDTXVMMITZPOQ-NRFANRHFSA-N |
| XLogP | 2.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |