C17H22N2O2 — CID 79309828
2-benzyl-11-methyl-2,9-diazaspiro[5.5]undecane-8,10-dione (PubChem CID 79309828) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-benzyl-11-methyl-2,9-diazaspiro[5.5]undecane-8,10-dione.
| Compound Name | 2-benzyl-11-methyl-2,9-diazaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 79309828 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-benzyl-11-methyl-2,9-diazaspiro[5.5]undecane-8,10-dione |
| SMILES | CC1C(=O)NC(=O)CC12CCCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H22N2O2/c1-13-16(21)18-15(20)10-17(13)8-5-9-19(12-17)11-14-6-3-2-4-7-14/h2-4,6-7,13H,5,8-12H2,1H3,(H,18,20,21) |
| InChIKey | XEQBVXYTCYVMHW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|