C13H22N2O2S — CID 113474380
1-(2-ethylsulfanylethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 113474380) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 1-(2-ethylsulfanylethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 113474380 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | CCSCCN1C(=O)NC(=O)C12CCCCCC2 |
| InChI | InChI=1S/C13H22N2O2S/c1-2-18-10-9-15-12(17)14-11(16)13(15)7-5-3-4-6-8-13/h2-10H2,1H3,(H,14,16,17) |
| InChIKey | VNEOMXPCLNGIQD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|