C9H15N3O2 — CID 83880106
1-methyl-1,3,9-triazaspiro[4.6]undecane-2,4-dione (PubChem CID 83880106) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-methyl-1,3,9-triazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 1-methyl-1,3,9-triazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 83880106 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-methyl-1,3,9-triazaspiro[4.6]undecane-2,4-dione |
| SMILES | CN1C(=O)NC(=O)C12CCCNCC2 |
| InChI | InChI=1S/C9H15N3O2/c1-12-8(14)11-7(13)9(12)3-2-5-10-6-4-9/h10H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | KHVGWPORDIOSQB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|