C8H13N3OS — CID 154381119
1-methyl-4-sulfanylidene-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 154381119) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-methyl-4-sulfanylidene-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1-methyl-4-sulfanylidene-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 154381119 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-methyl-4-sulfanylidene-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1C(=O)NC(=S)C12CCNCC2 |
| InChI | InChI=1S/C8H13N3OS/c1-11-7(12)10-6(13)8(11)2-4-9-5-3-8/h9H,2-5H2,1H3,(H,10,12,13) |
| InChIKey | LTHMVJSPEISMPZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|