C8H15N3OS — CID 141162752
1-methyl-4-sulfanyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 141162752) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-methyl-4-sulfanyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1-methyl-4-sulfanyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 141162752 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-methyl-4-sulfanyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1C(=O)NC(S)C12CCNCC2 |
| InChI | InChI=1S/C8H15N3OS/c1-11-7(12)10-6(13)8(11)2-4-9-5-3-8/h6,9,13H,2-5H2,1H3,(H,10,12) |
| InChIKey | GFPFJYLRBLKLRE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|