C13H18N2O2 — CID 105494683
1-methylspiro[3H-indole-2,4'-piperidine]-3,5-diol (PubChem CID 105494683) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-methylspiro[3H-indole-2,4'-piperidine]-3,5-diol.
| Compound Name | 1-methylspiro[3H-indole-2,4'-piperidine]-3,5-diol |
|---|---|
| PubChem CID | 105494683 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-methylspiro[3H-indole-2,4'-piperidine]-3,5-diol |
| SMILES | CN1c2ccc(O)cc2C(O)C12CCNCC2 |
| InChI | InChI=1S/C13H18N2O2/c1-15-11-3-2-9(16)8-10(11)12(17)13(15)4-6-14-7-5-13/h2-3,8,12,14,16-17H,4-7H2,1H3 |
| InChIKey | GWMIXHJVIHXSMT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |