C12H15NO3 — CID 105477452
spiro[3H-1-benzofuran-2,4'-piperidine]-3,6-diol (PubChem CID 105477452) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is spiro[3H-1-benzofuran-2,4'-piperidine]-3,6-diol.
| Compound Name | spiro[3H-1-benzofuran-2,4'-piperidine]-3,6-diol |
|---|---|
| PubChem CID | 105477452 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | spiro[3H-1-benzofuran-2,4'-piperidine]-3,6-diol |
| SMILES | Oc1ccc2c(c1)OC1(CCNCC1)C2O |
| InChI | InChI=1S/C12H15NO3/c14-8-1-2-9-10(7-8)16-12(11(9)15)3-5-13-6-4-12/h1-2,7,11,13-15H,3-6H2 |
| InChIKey | OTHIVHPHCZNUEK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |