C23H27FN2O5 — CID 123726802
N-[2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-3-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide (PubChem CID 123726802) has the molecular formula C23H27FN2O5 and a molecular weight of 430.48 g/mol. Its IUPAC name is N-[2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-3-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide.
| Compound Name | N-[2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-3-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 123726802 |
| Molecular Formula | C23H27FN2O5 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[2-[(2S)-3-(5-fluorospiro[3H-1-benzofuran-2,4'-piperidine]-3-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(O)cc1OC[C@@H](O)CC1c2cc(F)ccc2OC12CCNCC2 |
| InChI | InChI=1S/C23H27FN2O5/c1-14(27)26-20-4-3-16(28)12-22(20)30-13-17(29)11-19-18-10-15(24)2-5-21(18)31-23(19)6-8-25-9-7-23/h2-5,10,12,17,19,25,28-29H,6-9,11,13H2,1H3,(H,26,27)/t17-,19?/m0/s1 |
| InChIKey | LYVPRPQEPMTXHA-KKFHFHRHSA-N |
| XLogP | 2.92 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|