C22H25ClN2O6 — CID 10460507
N-[2-[(2S)-3-(5-chlorospiro[1,3-benzodioxole-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide (PubChem CID 10460507) has the molecular formula C22H25ClN2O6 and a molecular weight of 448.90 g/mol. Its IUPAC name is N-[2-[(2S)-3-(5-chlorospiro[1,3-benzodioxole-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide.
| Compound Name | N-[2-[(2S)-3-(5-chlorospiro[1,3-benzodioxole-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 10460507 |
| Molecular Formula | C22H25ClN2O6 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[2-[(2S)-3-(5-chlorospiro[1,3-benzodioxole-2,4'-piperidine]-1'-yl)-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(O)cc1OC[C@@H](O)CN1CCC2(CC1)Oc1ccc(Cl)cc1O2 |
| InChI | InChI=1S/C22H25ClN2O6/c1-14(26)24-18-4-3-16(27)11-20(18)29-13-17(28)12-25-8-6-22(7-9-25)30-19-5-2-15(23)10-21(19)31-22/h2-5,10-11,17,27-28H,6-9,12-13H2,1H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | PRCGNNOLGSGSJZ-KRWDZBQOSA-N |
| XLogP | 3.01 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|