C22H26ClN3O5 — CID 25116462
N-[2-[(2R)-3-[4-[(4-chlorophenyl)methyl]-2-oxopiperazin-1-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide (PubChem CID 25116462) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[2-[(2R)-3-[4-[(4-chlorophenyl)methyl]-2-oxopiperazin-1-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide.
| Compound Name | N-[2-[(2R)-3-[4-[(4-chlorophenyl)methyl]-2-oxopiperazin-1-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 25116462 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[2-[(2R)-3-[4-[(4-chlorophenyl)methyl]-2-oxopiperazin-1-yl]-2-hydroxypropoxy]-4-hydroxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(O)cc1OC[C@H](O)CN1CCN(Cc2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C22H26ClN3O5/c1-15(27)24-20-7-6-18(28)10-21(20)31-14-19(29)12-26-9-8-25(13-22(26)30)11-16-2-4-17(23)5-3-16/h2-7,10,19,28-29H,8-9,11-14H2,1H3,(H,24,27)/t19-/m1/s1 |
| InChIKey | QRWQNYIHIJUACJ-LJQANCHMSA-N |
| XLogP | 2.09 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|