C24H32ClN3O3 — CID 71214805
N-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide (PubChem CID 71214805) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is N-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide.
| Compound Name | N-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide |
|---|---|
| PubChem CID | 71214805 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(O)cc1OCCCNC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H32ClN3O3/c1-2-24(30)27-22-9-8-21(29)16-23(22)31-15-3-12-26-20-10-13-28(14-11-20)17-18-4-6-19(25)7-5-18/h4-9,16,20,26,29H,2-3,10-15,17H2,1H3,(H,27,30) |
| InChIKey | LAUKAMUNVONHMJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|