C23H30ClN3O3 — CID 24566651
2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(2,5-diethoxyphenyl)acetamide (PubChem CID 24566651) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(2,5-diethoxyphenyl)acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(2,5-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24566651 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-N-(2,5-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CN2CCN(Cc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H30ClN3O3/c1-3-29-20-9-10-22(30-4-2)21(15-20)25-23(28)17-27-13-11-26(12-14-27)16-18-5-7-19(24)8-6-18/h5-10,15H,3-4,11-14,16-17H2,1-2H3,(H,25,28) |
| InChIKey | IGGLJOZXOPXQEH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |