C23H27F3N4O3 — CID 34932292
2-[[2-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 34932292) has the molecular formula C23H27F3N4O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-[[2-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 34932292 |
| Molecular Formula | C23H27F3N4O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[[2-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCOc1ccc(CN2CCN(CC(=O)NCC(=O)Nc3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C23H27F3N4O3/c1-2-33-17-5-3-16(4-6-17)14-29-9-11-30(12-10-29)15-21(32)27-13-20(31)28-19-8-7-18(24)22(25)23(19)26/h3-8H,2,9-15H2,1H3,(H,27,32)(H,28,31) |
| InChIKey | JNFZNXQXOBOXKE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|