C21H20F6N4O3 — CID 29164788
2-[4-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 29164788) has the molecular formula C21H20F6N4O3 and a molecular weight of 490.40 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 29164788 |
| Molecular Formula | C21H20F6N4O3 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[4-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)Nc2ccc(F)c(F)c2F)CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F6N4O3/c22-15-5-6-16(20(24)19(15)23)29-18(33)12-31-9-7-30(8-10-31)11-17(32)28-13-1-3-14(4-2-13)34-21(25,26)27/h1-6H,7-12H2,(H,28,32)(H,29,33) |
| InChIKey | WCKNNDBYZQMCBZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|