C15H21F3N4O4S — CID 34781907
2-[4-(dimethylsulfamoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 34781907) has the molecular formula C15H21F3N4O4S and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[4-(dimethylsulfamoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 34781907 |
| Molecular Formula | C15H21F3N4O4S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)piperazin-1-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(CC(=O)Nc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H21F3N4O4S/c1-20(2)27(24,25)22-9-7-21(8-10-22)11-14(23)19-12-3-5-13(6-4-12)26-15(16,17)18/h3-6H,7-11H2,1-2H3,(H,19,23) |
| InChIKey | OAMYRKIKIVRCRG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |