C19H20F3N3O5S — CID 34697895
N-(4-hydroxyphenyl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 34697895) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(4-hydroxyphenyl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 34697895 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20F3N3O5S/c20-19(21,22)30-16-5-7-17(8-6-16)31(28,29)25-11-9-24(10-12-25)13-18(27)23-14-1-3-15(26)4-2-14/h1-8,26H,9-13H2,(H,23,27) |
| InChIKey | HLWOINJWQLXYDU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|