C18H26F3N3O4S — CID 26626370
N-(2-methylbutan-2-yl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 26626370) has the molecular formula C18H26F3N3O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-(2-methylbutan-2-yl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(2-methylbutan-2-yl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 26626370 |
| Molecular Formula | C18H26F3N3O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-(2-methylbutan-2-yl)-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | CCC(C)(C)NC(=O)CN1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3N3O4S/c1-4-17(2,3)22-16(25)13-23-9-11-24(12-10-23)29(26,27)15-7-5-14(6-8-15)28-18(19,20)21/h5-8H,4,9-13H2,1-3H3,(H,22,25) |
| InChIKey | YRJOTENWHINQNW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |