C24H31Cl2N3O3 — CID 71213581
N-[5-chloro-2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide (PubChem CID 71213581) has the molecular formula C24H31Cl2N3O3 and a molecular weight of 480.44 g/mol. Its IUPAC name is N-[5-chloro-2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide.
| Compound Name | N-[5-chloro-2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide |
|---|---|
| PubChem CID | 71213581 |
| Molecular Formula | C24H31Cl2N3O3 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[5-chloro-2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-hydroxyphenyl]propanamide |
| SMILES | CCC(=O)Nc1cc(Cl)c(O)cc1OCCCNC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H31Cl2N3O3/c1-2-24(31)28-21-14-20(26)22(30)15-23(21)32-13-3-10-27-19-8-11-29(12-9-19)16-17-4-6-18(25)7-5-17/h4-7,14-15,19,27,30H,2-3,8-13,16H2,1H3,(H,28,31) |
| InChIKey | RPEHYTSCHDHHBJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|