About 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride
4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride (PubChem CID 138039858) has the molecular formula C8H15ClN2O2
and a molecular weight of 206.67 g/mol. Its IUPAC name is 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride |
| PubChem CID | 138039858 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride |
| SMILES | CN1C(=O)COC12CCNCC2.Cl |
| InChI | InChI=1S/C8H14N2O2.ClH/c1-10-7(11)6-12-8(10)2-4-9-5-3-8;/h9H,2-6H2,1H3;1H |
| InChIKey | RMULBNWPEMXWGD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The IUPAC name of 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride (CID 138039858) is 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride.
What is the SMILES notation for 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The canonical SMILES for 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride is CN1C(=O)COC12CCNCC2.Cl.
What is the InChIKey of 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The InChIKey is RMULBNWPEMXWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2.ClH/c1-10-7(11)6-12-8(10)2-4-9-5-3-8;/h9H,2-6H2,1H3;1H.
What are the key properties of 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride has a molecular weight of 206.67 g/mol, XLogP of -0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride is sourced from PubChem (CID 138039858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).