C9H12N2O4 — CID 67113783
(8R)-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 67113783) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is (8R)-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (8R)-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 67113783 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (8R)-1-methyl-2,4-dioxo-1,3-diazaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | CN1C(=O)NC(=O)C12CC[C@@H](C(=O)O)C2 |
| InChI | InChI=1S/C9H12N2O4/c1-11-8(15)10-7(14)9(11)3-2-5(4-9)6(12)13/h5H,2-4H2,1H3,(H,12,13)(H,10,14,15)/t5-,9?/m1/s1 |
| InChIKey | SFBOUKMTHXTCGL-RRPHZQQHSA-N |
| XLogP | -0.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|