About cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid
cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid (PubChem CID 124578346) has the molecular formula C10H16Br2O2
and a molecular weight of 328.04 g/mol. Its IUPAC name is cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid |
| PubChem CID | 124578346 |
| Molecular Formula | C10H16Br2O2 |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid |
| SMILES | CC(C)[C@@]1(C(Br)Br)CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H16Br2O2/c1-6(2)10(9(11)12)4-3-7(5-10)8(13)14/h6-7,9H,3-5H2,1-2H3,(H,13,14)/t7-,10-/m1/s1 |
| InChIKey | SWHZBCXENNUQGH-GMSGAONNSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid (CID 124578346) is cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid is CC(C)[C@@]1(C(Br)Br)CC[C@@H](C(=O)O)C1.
What is the InChIKey of cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid?
The InChIKey is SWHZBCXENNUQGH-GMSGAONNSA-N. The full InChI is InChI=1S/C10H16Br2O2/c1-6(2)10(9(11)12)4-3-7(5-10)8(13)14/h6-7,9H,3-5H2,1-2H3,(H,13,14)/t7-,10-/m1/s1.
What are the key properties of cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid?
cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid has a molecular weight of 328.04 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 124578346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).