C10H16Br2O2 — CID 124578346
cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid (PubChem CID 124578346) has the molecular formula C10H16Br2O2 and a molecular weight of 328.04 g/mol. Its IUPAC name is cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 124578346 |
| Molecular Formula | C10H16Br2O2 |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | cis-(1R,3R)-3-(dibromomethyl)-3-propan-2-ylcyclopentane-1-carboxylic acid |
| SMILES | CC(C)[C@@]1(C(Br)Br)CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H16Br2O2/c1-6(2)10(9(11)12)4-3-7(5-10)8(13)14/h6-7,9H,3-5H2,1-2H3,(H,13,14)/t7-,10-/m1/s1 |
| InChIKey | SWHZBCXENNUQGH-GMSGAONNSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|