C11H20FNO2 — CID 105471452
3-fluoro-3-[(2-methylpropylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 105471452) has the molecular formula C11H20FNO2 and a molecular weight of 217.28 g/mol. Its IUPAC name is 3-fluoro-3-[(2-methylpropylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3-fluoro-3-[(2-methylpropylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 105471452 |
| Molecular Formula | C11H20FNO2 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-fluoro-3-[(2-methylpropylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | CC(C)CNCC1(F)CCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H20FNO2/c1-8(2)6-13-7-11(12)4-3-9(5-11)10(14)15/h8-9,13H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | JVKBWAXYEPORJH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |