C8H14N4S2 — CID 10561470
3,3a,4,6a-tetramethyl-1,6-dihydroimidazo[4,5-d]imidazole-2,5-dithione (PubChem CID 10561470) has the molecular formula C8H14N4S2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 3,3a,4,6a-tetramethyl-1,6-dihydroimidazo[4,5-d]imidazole-2,5-dithione.
| Compound Name | 3,3a,4,6a-tetramethyl-1,6-dihydroimidazo[4,5-d]imidazole-2,5-dithione |
|---|---|
| PubChem CID | 10561470 |
| Molecular Formula | C8H14N4S2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3,3a,4,6a-tetramethyl-1,6-dihydroimidazo[4,5-d]imidazole-2,5-dithione |
| SMILES | CN1C(=S)NC2(C)NC(=S)N(C)C12C |
| InChI | InChI=1S/C8H14N4S2/c1-7-8(2,11(3)5(13)9-7)12(4)6(14)10-7/h1-4H3,(H,9,13)(H,10,14) |
| InChIKey | WUFYKWZIOHRONV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|