C9H11NOS — CID 21300250
4,4,5-trimethylthieno[3,4-c]pyrrol-6-one (PubChem CID 21300250) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 4,4,5-trimethylthieno[3,4-c]pyrrol-6-one.
| Compound Name | 4,4,5-trimethylthieno[3,4-c]pyrrol-6-one |
|---|---|
| PubChem CID | 21300250 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4,4,5-trimethylthieno[3,4-c]pyrrol-6-one |
| SMILES | CN1C(=O)c2cscc2C1(C)C |
| InChI | InChI=1S/C9H11NOS/c1-9(2)7-5-12-4-6(7)8(11)10(9)3/h4-5H,1-3H3 |
| InChIKey | FRUMPYAMXZQADC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |