C9H13NOS2 — CID 21300131
1,1,3-trimethyl-4H-thieno[3,4-d]thiazine 2-oxide (PubChem CID 21300131) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1,1,3-trimethyl-4H-thieno[3,4-d]thiazine 2-oxide.
| Compound Name | 1,1,3-trimethyl-4H-thieno[3,4-d]thiazine 2-oxide |
|---|---|
| PubChem CID | 21300131 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 1,1,3-trimethyl-4H-thieno[3,4-d]thiazine 2-oxide |
| SMILES | CN1Cc2cscc2C(C)(C)S1=O |
| InChI | InChI=1S/C9H13NOS2/c1-9(2)8-6-12-5-7(8)4-10(3)13(9)11/h5-6H,4H2,1-3H3 |
| InChIKey | QLEQEKALGGWBIY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |