C11H14N4 — CID 14128511
5,11-dimethyl-4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene (PubChem CID 14128511) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5,11-dimethyl-4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene.
| Compound Name | 5,11-dimethyl-4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene |
|---|---|
| PubChem CID | 14128511 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5,11-dimethyl-4,5,11,12-tetrazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,12-tetraene |
| SMILES | Cn1ncc2c1CCCc1c-2cnn1C |
| InChI | InChI=1S/C11H14N4/c1-14-10-4-3-5-11-9(7-13-15(11)2)8(10)6-12-14/h6-7H,3-5H2,1-2H3 |
| InChIKey | WXQZIGQCUSBDMP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |