About 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine
4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine (PubChem CID 171459606) has the molecular formula C7H10ClN3
and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine |
| PubChem CID | 171459606 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine |
| SMILES | Cn1ncc2c1CCCN2Cl |
| InChI | InChI=1S/C7H10ClN3/c1-10-6-3-2-4-11(8)7(6)5-9-10/h5H,2-4H2,1H3 |
| InChIKey | WJKSMGJFAHIQCF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine?
The IUPAC name of 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine (CID 171459606) is 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine.
What is the SMILES notation for 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine?
The canonical SMILES for 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine is Cn1ncc2c1CCCN2Cl.
What is the InChIKey of 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine?
The InChIKey is WJKSMGJFAHIQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3/c1-10-6-3-2-4-11(8)7(6)5-9-10/h5H,2-4H2,1H3.
What are the key properties of 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine?
4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine has a molecular weight of 171.63 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine is sourced from PubChem (CID 171459606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).