C7H10ClN3 — CID 171459606
4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine (PubChem CID 171459606) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine.
| Compound Name | 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 171459606 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 4-chloro-1-methyl-6,7-dihydro-5H-pyrazolo[4,5-b]pyridine |
| SMILES | Cn1ncc2c1CCCN2Cl |
| InChI | InChI=1S/C7H10ClN3/c1-10-6-3-2-4-11(8)7(6)5-9-10/h5H,2-4H2,1H3 |
| InChIKey | WJKSMGJFAHIQCF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|