About 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine
4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine (PubChem CID 20784738) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine.
Analyze 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine?
The IUPAC name of 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine (CID 20784738) is 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine.
What is the SMILES notation for 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine?
The canonical SMILES for 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine is c1n[nH]c2c1NCCC2.
What is the InChIKey of 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine?
The InChIKey is RTTBBADOMOOPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-2-5-6(7-3-1)4-8-9-5/h4,7H,1-3H2,(H,8,9).
What are the key properties of 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine?
4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine has a molecular weight of 123.16 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1H-pyrazolo[4,5-b]pyridine is sourced from PubChem (CID 20784738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).