C6H6N4 — CID 136508234
1,7-dihydropyrazolo[4,5-b]pyridin-6-imine (PubChem CID 136508234) has the molecular formula C6H6N4 and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[4,5-b]pyridin-6-imine.
| Compound Name | 1,7-dihydropyrazolo[4,5-b]pyridin-6-imine |
|---|---|
| PubChem CID | 136508234 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1,7-dihydropyrazolo[4,5-b]pyridin-6-imine |
| SMILES | [H]/N=C1\C=Nc2cn[nH]c2C1 |
| InChI | InChI=1S/C6H6N4/c7-4-1-5-6(8-2-4)3-9-10-5/h2-3,7H,1H2,(H,9,10)/b7-4- |
| InChIKey | ZLSGTNOWRZSPPW-DAXSKMNVSA-N |
| XLogP | 0.69 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|