About 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid
2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid (PubChem CID 83908156) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid.
Analyze 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid (CID 83908156) is 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid is O=C(O)CC1(O)CCc2cscc21.
What is the InChIKey of 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid?
The InChIKey is BSSWRHIIMVORCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S/c10-8(11)3-9(12)2-1-6-4-13-5-7(6)9/h4-5,12H,1-3H2,(H,10,11).
What are the key properties of 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid?
2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid has a molecular weight of 198.24 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-5,6-dihydrocyclopenta[c]thiophen-4-yl)acetic acid is sourced from PubChem (CID 83908156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).