C12H17N3S — CID 781757
(5R)-5-methyl-2-phenyl-5-propan-2-yl-1,2,4-triazolidine-3-thione (PubChem CID 781757) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is (5R)-5-methyl-2-phenyl-5-propan-2-yl-1,2,4-triazolidine-3-thione.
| Compound Name | (5R)-5-methyl-2-phenyl-5-propan-2-yl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 781757 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (5R)-5-methyl-2-phenyl-5-propan-2-yl-1,2,4-triazolidine-3-thione |
| SMILES | CC(C)[C@]1(C)NC(=S)N(c2ccccc2)N1 |
| InChI | InChI=1S/C12H17N3S/c1-9(2)12(3)13-11(16)15(14-12)10-7-5-4-6-8-10/h4-9,14H,1-3H3,(H,13,16)/t12-/m1/s1 |
| InChIKey | DAEYJORFHFJBSZ-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|