C7H10N2OS — CID 21049415
3-methyl-5-propan-2-ylidene-2-sulfanylideneimidazolidin-4-one (PubChem CID 21049415) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-methyl-5-propan-2-ylidene-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-methyl-5-propan-2-ylidene-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 21049415 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-methyl-5-propan-2-ylidene-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(C)=C1NC(=S)N(C)C1=O |
| InChI | InChI=1S/C7H10N2OS/c1-4(2)5-6(10)9(3)7(11)8-5/h1-3H3,(H,8,11) |
| InChIKey | XDNVUKPEWQOOIL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|