C9H13N3OS — CID 101208978
(5Z)-3-methyl-5-(pyrrolidin-1-ylmethylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 101208978) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is (5Z)-3-methyl-5-(pyrrolidin-1-ylmethylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-methyl-5-(pyrrolidin-1-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 101208978 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (5Z)-3-methyl-5-(pyrrolidin-1-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=O)/C(=C/N2CCCC2)NC1=S |
| InChI | InChI=1S/C9H13N3OS/c1-11-8(13)7(10-9(11)14)6-12-4-2-3-5-12/h6H,2-5H2,1H3,(H,10,14)/b7-6- |
| InChIKey | BJDKJPFODVXCTP-SREVYHEPSA-N |
| XLogP | 0.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|