C14H22N4O3S — CID 10663904
1-[(3aR,6aR)-3,3a,4,6a-tetramethyl-5-oxo-2-sulfanylidene-1H-imidazo[4,5-d]imidazol-6-yl]-2-ethylbutane-1,3-dione (PubChem CID 10663904) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-[(3aR,6aR)-3,3a,4,6a-tetramethyl-5-oxo-2-sulfanylidene-1H-imidazo[4,5-d]imidazol-6-yl]-2-ethylbutane-1,3-dione.
| Compound Name | 1-[(3aR,6aR)-3,3a,4,6a-tetramethyl-5-oxo-2-sulfanylidene-1H-imidazo[4,5-d]imidazol-6-yl]-2-ethylbutane-1,3-dione |
|---|---|
| PubChem CID | 10663904 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[(3aR,6aR)-3,3a,4,6a-tetramethyl-5-oxo-2-sulfanylidene-1H-imidazo[4,5-d]imidazol-6-yl]-2-ethylbutane-1,3-dione |
| SMILES | CCC(C(C)=O)C(=O)N1C(=O)N(C)[C@]2(C)N(C)C(=S)N[C@]12C |
| InChI | InChI=1S/C14H22N4O3S/c1-7-9(8(2)19)10(20)18-12(21)17(6)14(4)13(18,3)15-11(22)16(14)5/h9H,7H2,1-6H3,(H,15,22)/t9?,13-,14+/m1/s1 |
| InChIKey | IBNGIASAAIWDOP-CTWBKRIHSA-N |
| XLogP | 0.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|