C14H22N4O4 — CID 10924947
(3aR,6aS)-6-(2-ethyl-3-oxobutanoyl)-3,3a,4,6a-tetramethyl-1H-imidazo[4,5-d]imidazole-2,5-dione (PubChem CID 10924947) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3aR,6aS)-6-(2-ethyl-3-oxobutanoyl)-3,3a,4,6a-tetramethyl-1H-imidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | (3aR,6aS)-6-(2-ethyl-3-oxobutanoyl)-3,3a,4,6a-tetramethyl-1H-imidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 10924947 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (3aR,6aS)-6-(2-ethyl-3-oxobutanoyl)-3,3a,4,6a-tetramethyl-1H-imidazo[4,5-d]imidazole-2,5-dione |
| SMILES | CCC(C(C)=O)C(=O)N1C(=O)N(C)[C@@]2(C)N(C)C(=O)N[C@@]12C |
| InChI | InChI=1S/C14H22N4O4/c1-7-9(8(2)19)10(20)18-12(22)17(6)14(4)13(18,3)15-11(21)16(14)5/h9H,7H2,1-6H3,(H,15,21)/t9?,13-,14+/m0/s1 |
| InChIKey | NMDZCZVMCRPXKQ-VOPCEASESA-N |
| XLogP | 0.58 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|