C10H19N3O2S — CID 163203057
3a,7a-dihydroxy-5-(propylamino)-1,3,4,5,6,7-hexahydrobenzimidazole-2-thione (PubChem CID 163203057) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 3a,7a-dihydroxy-5-(propylamino)-1,3,4,5,6,7-hexahydrobenzimidazole-2-thione.
| Compound Name | 3a,7a-dihydroxy-5-(propylamino)-1,3,4,5,6,7-hexahydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 163203057 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3a,7a-dihydroxy-5-(propylamino)-1,3,4,5,6,7-hexahydrobenzimidazole-2-thione |
| SMILES | CCCNC1CCC2(O)NC(=S)NC2(O)C1 |
| InChI | InChI=1S/C10H19N3O2S/c1-2-5-11-7-3-4-9(14)10(15,6-7)13-8(16)12-9/h7,11,14-15H,2-6H2,1H3,(H2,12,13,16) |
| InChIKey | METLESXUUOIWIY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|