About oxolane;4-(trifluoromethyl)piperidin-4-ol
oxolane;4-(trifluoromethyl)piperidin-4-ol (PubChem CID 175226361) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is oxolane;4-(trifluoromethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | oxolane;4-(trifluoromethyl)piperidin-4-ol |
| PubChem CID | 175226361 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | oxolane;4-(trifluoromethyl)piperidin-4-ol |
| SMILES | C1CCOC1.OC1(C(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C6H10F3NO.C4H8O/c7-6(8,9)5(11)1-3-10-4-2-5;1-2-4-5-3-1/h10-11H,1-4H2;1-4H2 |
| InChIKey | WVZZLJVOKDBJRI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxolane;4-(trifluoromethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;4-(trifluoromethyl)piperidin-4-ol?
The IUPAC name of oxolane;4-(trifluoromethyl)piperidin-4-ol (CID 175226361) is oxolane;4-(trifluoromethyl)piperidin-4-ol.
What is the SMILES notation for oxolane;4-(trifluoromethyl)piperidin-4-ol?
The canonical SMILES for oxolane;4-(trifluoromethyl)piperidin-4-ol is C1CCOC1.OC1(C(F)(F)F)CCNCC1.
What is the InChIKey of oxolane;4-(trifluoromethyl)piperidin-4-ol?
The InChIKey is WVZZLJVOKDBJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO.C4H8O/c7-6(8,9)5(11)1-3-10-4-2-5;1-2-4-5-3-1/h10-11H,1-4H2;1-4H2.
What are the key properties of oxolane;4-(trifluoromethyl)piperidin-4-ol?
oxolane;4-(trifluoromethyl)piperidin-4-ol has a molecular weight of 241.25 g/mol, XLogP of 1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;4-(trifluoromethyl)piperidin-4-ol is sourced from PubChem (CID 175226361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).