C13H12S4 — CID 102274523
3-[[2,3-bis(sulfanyl)phenyl]methyl]benzene-1,2-dithiol (PubChem CID 102274523) has the molecular formula C13H12S4 and a molecular weight of 296.51 g/mol. Its IUPAC name is 3-[[2,3-bis(sulfanyl)phenyl]methyl]benzene-1,2-dithiol.
| Compound Name | 3-[[2,3-bis(sulfanyl)phenyl]methyl]benzene-1,2-dithiol |
|---|---|
| PubChem CID | 102274523 |
| Molecular Formula | C13H12S4 |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 3-[[2,3-bis(sulfanyl)phenyl]methyl]benzene-1,2-dithiol |
| SMILES | Sc1cccc(Cc2cccc(S)c2S)c1S |
| InChI | InChI=1S/C13H12S4/c14-10-5-1-3-8(12(10)16)7-9-4-2-6-11(15)13(9)17/h1-6,14-17H,7H2 |
| InChIKey | NKXLSBYIYPAYDL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|