About [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane
[(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane (PubChem CID 102275492) has the molecular formula C12H22OSi
and a molecular weight of 210.39 g/mol. Its IUPAC name is [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane |
| PubChem CID | 102275492 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane |
| SMILES | C#CCC(C)(O[Si](C)(C)C)/C(C)=C/C |
| InChI | InChI=1S/C12H22OSi/c1-8-10-12(4,11(3)9-2)13-14(5,6)7/h1,9H,10H2,2-7H3/b11-9+ |
| InChIKey | OJBPIZNISYTTHR-PKNBQFBNSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane?
The IUPAC name of [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane (CID 102275492) is [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane.
What is the SMILES notation for [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane?
The canonical SMILES for [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane is C#CCC(C)(O[Si](C)(C)C)/C(C)=C/C.
What is the InChIKey of [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane?
The InChIKey is OJBPIZNISYTTHR-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H22OSi/c1-8-10-12(4,11(3)9-2)13-14(5,6)7/h1,9H,10H2,2-7H3/b11-9+.
What are the key properties of [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane?
[(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane has a molecular weight of 210.39 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,5-dimethylhept-5-en-1-yn-4-yl]oxy-trimethylsilane is sourced from PubChem (CID 102275492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).