C6H9FO2 — CID 102276935
(1S,2S)-3-fluorocyclohex-3-ene-1,2-diol (PubChem CID 102276935) has the molecular formula C6H9FO2 and a molecular weight of 132.13 g/mol. Its IUPAC name is (1S,2S)-3-fluorocyclohex-3-ene-1,2-diol.
| Compound Name | (1S,2S)-3-fluorocyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 102276935 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | (1S,2S)-3-fluorocyclohex-3-ene-1,2-diol |
| SMILES | O[C@@H]1C(F)=CCC[C@@H]1O |
| InChI | InChI=1S/C6H9FO2/c7-4-2-1-3-5(8)6(4)9/h2,5-6,8-9H,1,3H2/t5-,6+/m0/s1 |
| InChIKey | GRAIAUMFIKQGQB-NTSWFWBYSA-N |
| XLogP | 0.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |