C15H28O2 — CID 102277022
(1R)-1-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]hexan-1-ol (PubChem CID 102277022) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1R)-1-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]hexan-1-ol.
| Compound Name | (1R)-1-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 102277022 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (1R)-1-[(2R,3R)-3-[(Z)-hept-1-enyl]oxiran-2-yl]hexan-1-ol |
| SMILES | CCCCC/C=C\[C@H]1O[C@@H]1[C@H](O)CCCCC |
| InChI | InChI=1S/C15H28O2/c1-3-5-7-8-10-12-14-15(17-14)13(16)11-9-6-4-2/h10,12-16H,3-9,11H2,1-2H3/b12-10-/t13-,14-,15-/m1/s1 |
| InChIKey | FUERTMWILJPFJA-HQZAUCPKSA-N |
| XLogP | 3.83 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|