C26H31F2N5O2 — CID 10227845
[2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidin-1-yl]-[2-[3-(dimethylamino)propoxy]phenyl]methanone (PubChem CID 10227845) has the molecular formula C26H31F2N5O2 and a molecular weight of 483.56 g/mol. Its IUPAC name is [2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidin-1-yl]-[2-[3-(dimethylamino)propoxy]phenyl]methanone.
| Compound Name | [2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidin-1-yl]-[2-[3-(dimethylamino)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 10227845 |
| Molecular Formula | C26H31F2N5O2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidin-1-yl]-[2-[3-(dimethylamino)propoxy]phenyl]methanone |
| SMILES | CN(C)CCCOc1ccccc1C(=O)N1CCCCC1CNc1cnc2cc(F)c(F)cc2n1 |
| InChI | InChI=1S/C26H31F2N5O2/c1-32(2)11-7-13-35-24-10-4-3-9-19(24)26(34)33-12-6-5-8-18(33)16-30-25-17-29-22-14-20(27)21(28)15-23(22)31-25/h3-4,9-10,14-15,17-18H,5-8,11-13,16H2,1-2H3,(H,30,31) |
| InChIKey | DRJNEXLOEAVTJP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|