C23H19F3N4O3 — CID 69308206
2-[(2S)-2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidine-1-carbonyl]-7-fluoro-1-benzofuran-3-one (PubChem CID 69308206) has the molecular formula C23H19F3N4O3 and a molecular weight of 456.42 g/mol. Its IUPAC name is 2-[(2S)-2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidine-1-carbonyl]-7-fluoro-1-benzofuran-3-one.
| Compound Name | 2-[(2S)-2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidine-1-carbonyl]-7-fluoro-1-benzofuran-3-one |
|---|---|
| PubChem CID | 69308206 |
| Molecular Formula | C23H19F3N4O3 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[(2S)-2-[[(6,7-difluoroquinoxalin-2-yl)amino]methyl]piperidine-1-carbonyl]-7-fluoro-1-benzofuran-3-one |
| SMILES | O=C1c2cccc(F)c2OC1C(=O)N1CCCC[C@H]1CNc1cnc2cc(F)c(F)cc2n1 |
| InChI | InChI=1S/C23H19F3N4O3/c24-14-6-3-5-13-20(31)22(33-21(13)14)23(32)30-7-2-1-4-12(30)10-28-19-11-27-17-8-15(25)16(26)9-18(17)29-19/h3,5-6,8-9,11-12,22H,1-2,4,7,10H2,(H,28,29)/t12-,22?/m0/s1 |
| InChIKey | GPCXFPUFCDRTQW-BJDAYTSDSA-N |
| XLogP | 3.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|