About tert-butyl (5S)-5-hydroxyoctanoate
tert-butyl (5S)-5-hydroxyoctanoate (PubChem CID 102278484) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl (5S)-5-hydroxyoctanoate.
Molecular Properties
| Compound Name | tert-butyl (5S)-5-hydroxyoctanoate |
| PubChem CID | 102278484 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | tert-butyl (5S)-5-hydroxyoctanoate |
| SMILES | CCC[C@H](O)CCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24O3/c1-5-7-10(13)8-6-9-11(14)15-12(2,3)4/h10,13H,5-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | WUDPNOWOLGXJLM-JTQLQIEISA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (5S)-5-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S)-5-hydroxyoctanoate?
The IUPAC name of tert-butyl (5S)-5-hydroxyoctanoate (CID 102278484) is tert-butyl (5S)-5-hydroxyoctanoate.
What is the SMILES notation for tert-butyl (5S)-5-hydroxyoctanoate?
The canonical SMILES for tert-butyl (5S)-5-hydroxyoctanoate is CCC[C@H](O)CCCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (5S)-5-hydroxyoctanoate?
The InChIKey is WUDPNOWOLGXJLM-JTQLQIEISA-N. The full InChI is InChI=1S/C12H24O3/c1-5-7-10(13)8-6-9-11(14)15-12(2,3)4/h10,13H,5-9H2,1-4H3/t10-/m0/s1.
What are the key properties of tert-butyl (5S)-5-hydroxyoctanoate?
tert-butyl (5S)-5-hydroxyoctanoate has a molecular weight of 216.32 g/mol, XLogP of 2.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S)-5-hydroxyoctanoate is sourced from PubChem (CID 102278484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).