C16H15Cl2IN2O7 — CID 102282281
6-[(2,6-dichlorophenoxy)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 102282281) has the molecular formula C16H15Cl2IN2O7 and a molecular weight of 545.11 g/mol. Its IUPAC name is 6-[(2,6-dichlorophenoxy)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 6-[(2,6-dichlorophenoxy)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102282281 |
| Molecular Formula | C16H15Cl2IN2O7 |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | 6-[(2,6-dichlorophenoxy)methyl]-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(COc2c(Cl)cccc2Cl)c1I |
| InChI | InChI=1S/C16H15Cl2IN2O7/c17-6-2-1-3-7(18)13(6)27-5-8-10(19)14(25)20-16(26)21(8)15-12(24)11(23)9(4-22)28-15/h1-3,9,11-12,15,22-24H,4-5H2,(H,20,25,26)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | CKJCTLJCMYAHCD-SDBHATRESA-N |
| XLogP | 0.64 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|