C16H17ClN2O8 — CID 67436350
2-chlorobenzoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 67436350) has the molecular formula C16H17ClN2O8 and a molecular weight of 400.77 g/mol. Its IUPAC name is 2-chlorobenzoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 2-chlorobenzoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67436350 |
| Molecular Formula | C16H17ClN2O8 |
| Molecular Weight | 400.77 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-chlorobenzoic acid;1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=C(O)c1ccccc1Cl.O=c1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O6.C7H5ClO2/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16;8-6-4-2-1-3-5(6)7(9)10/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16);1-4H,(H,9,10)/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | KGVZDUHFKLZMQS-IAIGYFSYSA-N |
| XLogP | -0.81 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.77 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |